CAS 898767-24-3

7-(3-fluorophenyl)-7-oxo-heptanenitrile

Description:

7-(3-Fluorophenyl)-7-oxo-heptanenitrile, identified by its CAS number 898767-24-3, is a chemical compound characterized by its unique structure, which includes a heptane backbone with a ketone functional group and a nitrile group. The presence of the 3-fluorophenyl substituent introduces both aromaticity and electronegativity due to the fluorine atom, which can influence the compound's reactivity and polarity. This compound is likely to exhibit moderate solubility in organic solvents, owing to its hydrophobic heptane chain and the polar nitrile group. Its functional groups suggest potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical reactions. The compound's stability and reactivity can be affected by the presence of the fluorine atom, which may enhance its electrophilic character. Overall, 7-(3-fluorophenyl)-7-oxo-heptanenitrile is a compound of interest in various chemical research fields, particularly in the development of new materials or therapeutic agents.

Formula: C₁₃H₁₄FNO

InChI: InChI=1/C13H14FNO/c14-12-7-5-6-11(10-12)13(16)8-3-1-2-4-9-15/h5-7,10H,1-4,8H2

SMILES: C(CCC#N)CCC(=O)c1cccc(c1)F