CymitQuimica logo

CAS 898767-25-4

:

8-(3-bromo-4-methyl-phenyl)-8-oxo-octanoic acid

Description:
8-(3-Bromo-4-methyl-phenyl)-8-oxo-octanoic acid is a chemical compound characterized by its unique structure, which includes an octanoic acid backbone with a ketone functional group and a substituted phenyl ring. The presence of the bromine atom and a methyl group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts and esters. The bromine substitution may enhance its lipophilicity, influencing its solubility in organic solvents. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis due to its functional groups. Its specific interactions and reactivity would depend on the surrounding environment and conditions, making it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C15H19BrO3
InChI:InChI=1/C15H19BrO3/c1-11-8-9-12(10-13(11)16)14(17)6-4-2-3-5-7-15(18)19/h8-10H,2-7H2,1H3,(H,18,19)
SMILES:Cc1ccc(cc1Br)C(=O)CCCCCCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.