CAS 898767-31-2

5-(4-bromo-2-methyl-phenyl)-5-oxo-pentanoic acid

Description:

5-(4-bromo-2-methyl-phenyl)-5-oxo-pentanoic acid is an organic compound characterized by its unique structure, which includes a pentanoic acid backbone with a ketone functional group and a brominated aromatic substituent. The presence of the 4-bromo-2-methylphenyl group contributes to its hydrophobic characteristics, while the carboxylic acid group provides acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic component. The bromine atom introduces additional reactivity, making it a potential candidate for further chemical modifications or reactions, such as nucleophilic substitutions or coupling reactions. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 5-(4-bromo-2-methyl-phenyl)-5-oxo-pentanoic acid is a compound of interest in synthetic organic chemistry due to its functional groups and potential reactivity.

Formula: C₁₂H₁₃BrO₃

InChI: InChI=1/C12H13BrO3/c1-8-7-9(13)5-6-10(8)11(14)3-2-4-12(15)16/h5-7H,2-4H2,1H3,(H,15,16)

SMILES: Cc1cc(ccc1C(=O)CCCC(=O)O)Br

5-(4-bromo-2-methylphenyl)-5-oxovaleric acid

CAS: 898767-31-2

Formula: C₁₂H₁₃BrO₃

Purity: 97.0%

Molecular weight: 285.137

Ref: 10-F207302