CymitQuimica logo

CAS 898767-33-4

:

5-(2-fluorophenyl)-5-oxo-pentanenitrile

Description:
5-(2-Fluorophenyl)-5-oxo-pentanenitrile, identified by its CAS number 898767-33-4, is a chemical compound that features a pentanenitrile backbone with a fluorophenyl substituent. This compound typically exhibits characteristics common to nitriles, such as a high boiling point and moderate solubility in organic solvents due to the presence of the nitrile functional group. The fluorophenyl group can influence its reactivity and polarity, potentially enhancing its interactions in various chemical environments. The presence of the carbonyl group (5-oxo) suggests that it may participate in reactions typical of ketones, such as nucleophilic addition. Additionally, the fluorine atom can impart unique electronic properties, affecting the compound's stability and reactivity. Overall, this compound may be of interest in pharmaceutical or materials chemistry due to its structural features, which could lead to specific biological or chemical activities. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C11H10FNO
InChI:InChI=1/C11H10FNO/c12-10-6-2-1-5-9(10)11(14)7-3-4-8-13/h1-2,5-6H,3-4,7H2
SMILES:c1ccc(c(c1)C(=O)CCCC#N)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.