CAS 898767-52-7

2-Iodo-δ-oxobenzenepentanoic acid

Description:

2-Iodo-δ-oxobenzenepentanoic acid, identified by its CAS number 898767-52-7, is a chemical compound that features a unique structure combining an iodo substituent with a pentanoic acid backbone and a ketone functional group. This compound is characterized by the presence of an iodine atom, which can influence its reactivity and biological activity. The δ-oxobenzenepentanoic acid structure suggests that it contains a benzene ring with a ketone group adjacent to a pentanoic acid chain, which may impart specific properties such as solubility and polarity. The presence of the iodo group can enhance the compound's potential for nucleophilic substitution reactions, making it useful in various synthetic applications. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Overall, 2-Iodo-δ-oxobenzenepentanoic acid represents a versatile building block in organic synthesis and medicinal chemistry, with potential applications in drug development and material science.

Formula: C₁₁H₁₁IO₃

InChI: InChI=1S/C11H11IO3/c12-9-5-2-1-4-8(9)10(13)6-3-7-11(14)15/h1-2,4-5H,3,6-7H2,(H,14,15)

InChI key: InChIKey=SOXUCLXJBYUZNH-UHFFFAOYSA-N

SMILES: C(CCCC(O)=O)(=O)C1=C(I)C=CC=C1

Synonyms:

• Benzenepentanoic acid, 2-iodo-δ-oxo-
• 2-Iodo-δ-oxobenzenepentanoic acid