CAS 898767-53-8

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898767-53-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3-fluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its chemical reactivity and potential biological activity. The molecular structure suggests that it may exhibit interesting properties such as lipophilicity, which can influence its solubility and interaction with biological systems. Additionally, the compound's unique arrangement of substituents may impart specific pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be of interest in the development of pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₁₅H₁₁ClF₂O

InChI: InChI=1S/C15H11ClF2O/c16-12-7-11(8-14(18)9-12)15(19)5-4-10-2-1-3-13(17)6-10/h1-3,6-9H,4-5H2

InChI key: InChIKey=QMLLJZNOOUCUIB-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 1-(3-Chloro-5-fluorophenyl)-3-(3-fluorophenyl)-1-propanone
• 3′-Chloro-5′-fluoro-3-(3-fluorophenyl)propiophenone
• 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-fluorophenyl)-

3′-chloro-5′-fluoro-3-(3-fluorophenyl)propiophenone

CAS: 898767-53-8

Formula: C₁₅H₁₁ClF₂O

Purity: 97.0%

Molecular weight: 280.7

Ref: 10-F206290