CAS 898767-56-1
:4-Cyano-η-oxobenzeneoctanenitrile
Description:
4-Cyano-η-oxobenzeneoctanenitrile, identified by its CAS number 898767-56-1, is a chemical compound that features a cyano group (-CN) and an oxobenzene structure, indicating the presence of a benzene ring with a carbonyl group (C=O) and a long octane chain. This compound is characterized by its potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in pharmaceuticals. The presence of the cyano group contributes to its reactivity, making it useful in nucleophilic addition reactions. Additionally, the octane chain enhances its hydrophobic properties, which can influence solubility and interaction with biological systems. The compound's stability and reactivity can be affected by environmental factors such as temperature and pH. Overall, 4-Cyano-η-oxobenzeneoctanenitrile is a versatile compound with unique structural features that lend it various chemical properties and potential applications in different fields of chemistry.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c16-11-5-3-1-2-4-6-15(18)14-9-7-13(12-17)8-10-14/h7-10H,1-6H2
InChI key:InChIKey=VKTGAIBPXWVTQT-UHFFFAOYSA-N
SMILES:C(CCCCCCC#N)(=O)C1=CC=C(C#N)C=C1
Synonyms:- Benzeneoctanenitrile, 4-cyano-η-oxo-
- 4-Cyano-η-oxobenzeneoctanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.