CAS 898767-59-4

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898767-59-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,4-dichlorophenyl group and a 3-fluorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can influence their solubility in organic solvents. Additionally, the presence of halogen substituents may enhance the compound's stability and alter its electronic properties, making it of interest in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1S/C15H11Cl2FO/c16-11-5-6-13(14(17)9-11)15(19)7-4-10-2-1-3-12(18)8-10/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=IHIQBQHQNGXAAI-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=C(Cl)C=C(Cl)C=C2

Synonyms:

• 1-(2,4-Dichlorophenyl)-3-(3-fluorophenyl)-1-propanone
• 1-Propanone, 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-