CAS 898767-63-0

1-(3,4-Dichlorophenyl)-3-(3-fluorophenyl)-1-propanone

Description:

1-(3,4-Dichlorophenyl)-3-(3-fluorophenyl)-1-propanone, identified by its CAS number 898767-63-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone substituted with a dichlorophenyl group and a fluorophenyl group, which contribute to its chemical reactivity and potential biological activity. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and stability of the molecule, making it of interest in various fields, including medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. Additionally, the compound's unique arrangement of substituents may influence its interaction with biological targets, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1S/C15H11Cl2FO/c16-13-6-5-11(9-14(13)17)15(19)7-4-10-2-1-3-12(18)8-10/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=FKRXAJVLELVUAY-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 1-Propanone, 1-(3,4-dichlorophenyl)-3-(3-fluorophenyl)-
• 1-(3,4-Dichlorophenyl)-3-(3-fluorophenyl)-1-propanone
• 3′,4′-Dichloro-3-(3-fluorophenyl)propiophenone

3′,4′-Dichloro-3-(3-fluorophenyl)propiophenone

CAS: 898767-63-0

Formula: C₁₅H₁₁Cl₂FO

Purity: 97.0%

Molecular weight: 297.15

Ref: 10-F206295