CAS 898767-66-3
:3-(7-cyanoheptanoyl)benzonitrile
Description:
3-(7-Cyanoheptanoyl)benzonitrile is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a cyanoheptanoyl group. The presence of the cyano group (-CN) indicates that it has a strong electron-withdrawing capability, which can influence its reactivity and interactions with other molecules. The heptanoyl chain contributes to its hydrophobic characteristics, potentially affecting its solubility in various solvents. This compound may exhibit interesting properties such as fluorescence or specific binding affinities due to its structural features. It is likely to be used in synthetic organic chemistry, possibly as an intermediate in the synthesis of more complex molecules or in materials science applications. The compound's CAS number, 898767-66-3, allows for its identification in chemical databases, facilitating research and development. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c16-10-5-3-1-2-4-9-15(18)14-8-6-7-13(11-14)12-17/h6-8,11H,1-5,9H2
SMILES:C(CCCC(=O)c1cccc(c1)C#N)CCC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.