CAS 898767-73-2

3-(3-fluorophenyl)-1-(3,4,5-trifluorophenyl)propan-1-one

Description:

3-(3-fluorophenyl)-1-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898767-73-2, is an organic compound characterized by its complex fluorinated aromatic structure. This compound features a propanone backbone, which is a ketone functional group, and is substituted with two distinct aromatic rings: one containing a single fluorine atom and the other containing three fluorine atoms. The presence of these fluorine substituents significantly influences the compound's physical and chemical properties, such as increased lipophilicity and potential biological activity. The fluorinated phenyl groups can enhance the compound's stability and reactivity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitutions and possibly fluorination reactions. Overall, this compound exemplifies the importance of fluorinated compounds in enhancing the properties of organic molecules.

Formula: C₁₅H₁₀F₄O

InChI: InChI=1/C15H10F4O/c16-11-3-1-2-9(6-11)4-5-14(20)10-7-12(17)15(19)13(18)8-10/h1-3,6-8H,4-5H2

SMILES: c1cc(CCC(=O)c2cc(c(c(c2)F)F)F)cc(c1)F