CymitQuimica logo

CAS 898767-75-4

:

1-Propanone, 1-(2,6-dichlorophenyl)-3-(3-fluorophenyl)-

Description:
1-Propanone, 1-(2,6-dichlorophenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898767-75-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a fluorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as lipophilicity, which can influence their solubility in organic solvents and their interaction with biological systems. The specific arrangement of substituents can also affect the compound's stability, melting and boiling points, and reactivity in various chemical reactions. Additionally, due to the presence of halogen atoms, this compound may have applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C15H11Cl2FO
InChI:InChI=1S/C15H11Cl2FO/c16-12-5-2-6-13(17)15(12)14(19)8-7-10-3-1-4-11(18)9-10/h1-6,9H,7-8H2
InChI key:InChIKey=XKBQVJWZFPBGJT-UHFFFAOYSA-N
SMILES:C(CCC1=CC(F)=CC=C1)(=O)C2=C(Cl)C=CC=C2Cl
Synonyms:
  • 1-Propanone, 1-(2,6-dichlorophenyl)-3-(3-fluorophenyl)-
  • 1-(2,6-Dichlorophenyl)-3-(3-fluorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.