CAS 898767-77-6

1-cyclopropyl-3-(3-fluorophenyl)propan-1-one

Description:

1-Cyclopropyl-3-(3-fluorophenyl)propan-1-one is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a fluorophenyl moiety attached to a propanone backbone. This compound typically exhibits properties common to ketones, such as being a liquid at room temperature with a distinct odor. The presence of the cyclopropyl group can impart strain and influence the compound's reactivity, while the fluorophenyl group may enhance lipophilicity and affect biological activity due to the electronegative fluorine atom. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the cyclopropyl and phenyl groups can lead to variations in biological activity. Additionally, its unique characteristics may allow it to participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₃FO

InChI: InChI=1/C12H13FO/c13-11-3-1-2-9(8-11)4-7-12(14)10-5-6-10/h1-3,8,10H,4-7H2

SMILES: c1cc(CCC(=O)C2CC2)cc(c1)F