CymitQuimica logo

CAS 898767-79-8

:

1-Cyclobutyl-3-(3-fluorophenyl)-1-propanone

Description:
1-Cyclobutyl-3-(3-fluorophenyl)-1-propanone, identified by its CAS number 898767-79-8, is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a 3-fluorophenyl moiety attached to a propanone backbone. This compound typically exhibits properties common to ketones, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclobutyl and phenyl groups. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Its applications may span various fields, including pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C13H15FO
InChI:InChI=1S/C13H15FO/c14-12-6-1-3-10(9-12)7-8-13(15)11-4-2-5-11/h1,3,6,9,11H,2,4-5,7-8H2
InChI key:InChIKey=RMMFTTFVQWATSV-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCC1)C2=CC(F)=CC=C2
Synonyms:
  • 1-Propanone, 1-cyclobutyl-3-(3-fluorophenyl)-
  • 1-Cyclobutyl-3-(3-fluorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.