CAS 898767-81-2
:1-cyclopentyl-3-(3-fluorophenyl)propan-1-one
Description:
1-Cyclopentyl-3-(3-fluorophenyl)propan-1-one, identified by its CAS number 898767-81-2, is an organic compound characterized by its ketone functional group and a unique structure that includes a cyclopentyl ring and a fluorophenyl substituent. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both cyclic and aromatic components that can influence biological activity. The fluorine atom in the phenyl group may enhance lipophilicity and metabolic stability, making it an interesting candidate for further research. Additionally, the compound's reactivity can be influenced by the presence of the cyclopentyl group, which may affect its interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks if ingested or inhaled.
Formula:C14H17FO
InChI:InChI=1/C14H17FO/c15-13-7-3-4-11(10-13)8-9-14(16)12-5-1-2-6-12/h3-4,7,10,12H,1-2,5-6,8-9H2
SMILES:C1CCC(C1)C(=O)CCc1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.