CAS 898767-83-4
:1-cyclohexyl-3-(3-fluorophenyl)propan-1-one
Description:
1-Cyclohexyl-3-(3-fluorophenyl)propan-1-one, identified by its CAS number 898767-83-4, is an organic compound characterized by its ketone functional group and a unique structure that includes a cyclohexyl group and a fluorophenyl substituent. This compound typically exhibits a moderate to high molecular weight and is likely to be a solid at room temperature, given the presence of bulky groups that can influence its physical state. The fluorine atom in the 3-position of the phenyl ring can enhance the compound's lipophilicity and may affect its reactivity and biological activity. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. Its potential applications could span fields such as pharmaceuticals, where it may serve as an intermediate or a lead compound in drug development. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C15H19FO
InChI:InChI=1/C15H19FO/c16-14-8-4-5-12(11-14)9-10-15(17)13-6-2-1-3-7-13/h4-5,8,11,13H,1-3,6-7,9-10H2
SMILES:C1CCC(CC1)C(=O)CCc1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.