CAS 898767-88-9
:7-(4-iodophenyl)-7-oxo-heptanenitrile
Description:
7-(4-Iodophenyl)-7-oxo-heptanenitrile is a chemical compound characterized by its unique structure, which includes a heptane backbone with a ketone functional group and a nitrile group. The presence of the 4-iodophenyl substituent introduces significant polarity and potential for various chemical interactions, making it a compound of interest in organic synthesis and medicinal chemistry. The nitrile group contributes to the compound's reactivity, allowing for potential transformations in synthetic pathways. Additionally, the iodine atom can enhance the compound's biological activity and influence its pharmacokinetic properties. This compound may exhibit specific physical properties such as solubility in organic solvents and varying melting or boiling points, depending on its molecular interactions. Its CAS number, 898767-88-9, serves as a unique identifier for regulatory and safety information. Overall, 7-(4-iodophenyl)-7-oxo-heptanenitrile is a versatile compound with potential applications in research and development within the fields of chemistry and pharmaceuticals.
Formula:C13H14INO
InChI:InChI=1/C13H14INO/c14-12-8-6-11(7-9-12)13(16)5-3-1-2-4-10-15/h6-9H,1-5H2
SMILES:C(CCC#N)CCC(=O)c1ccc(cc1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.