CAS 898768-00-8

ethyl 2-[3-(4-fluorophenyl)propanoyl]benzoate

Description:

Ethyl 2-[3-(4-fluorophenyl)propanoyl]benzoate, identified by its CAS number 898768-00-8, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a benzoate moiety linked to a propanoyl group that contains a para-fluorophenyl substituent, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Ethyl 2-[3-(4-fluorophenyl)propanoyl]benzoate is likely to exhibit moderate solubility in organic solvents and limited solubility in water, typical of many aromatic esters. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the fluorine substituent, which may affect its interactions in biological systems. Overall, this compound represents a class of organic molecules with diverse applications in chemical synthesis and drug development.

Formula: C₁₈H₁₇FO₃

InChI: InChI=1/C18H17FO3/c1-2-22-18(21)16-6-4-3-5-15(16)17(20)12-9-13-7-10-14(19)11-8-13/h3-8,10-11H,2,9,12H2,1H3

SMILES: CCOC(=O)c1ccccc1C(=O)CCc1ccc(cc1)F