CAS 898768-01-9
:4-(2-iodophenyl)-4-oxo-butanenitrile
Description:
4-(2-Iodophenyl)-4-oxo-butanenitrile, identified by its CAS number 898768-01-9, is an organic compound characterized by its unique molecular structure, which includes a butanenitrile backbone substituted with a 2-iodophenyl group and a ketone functional group. This compound typically exhibits a moderate to high degree of lipophilicity due to the presence of the iodine atom and the aromatic ring, which can influence its solubility in organic solvents. The nitrile functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the presence of the ketone group may allow for further functionalization, enhancing its utility in synthetic organic chemistry. Its potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and biological activity. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C10H8INO
InChI:InChI=1/C10H8INO/c11-9-5-2-1-4-8(9)10(13)6-3-7-12/h1-2,4-5H,3,6H2
SMILES:c1ccc(c(c1)C(=O)CCC#N)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.