CAS 898768-07-5

1-Propanone, 1-(2,5-dichlorophenyl)-3-(3-methylphenyl)-

Description:

1-Propanone, 1-(2,5-dichlorophenyl)-3-(3-methylphenyl)-, also known by its CAS number 898768-07-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a methylphenyl group. The presence of chlorine atoms on the phenyl ring contributes to its chemical reactivity and potential biological activity. The compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its hydrophobic aromatic components. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of multiple functional groups may influence its physical properties, such as boiling and melting points, as well as its reactivity in various chemical reactions. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₆H₁₄Cl₂O

InChI: InChI=1S/C16H14Cl2O/c1-11-3-2-4-12(9-11)5-8-16(19)14-10-13(17)6-7-15(14)18/h2-4,6-7,9-10H,5,8H2,1H3

InChI key: InChIKey=DSQXMKROZZQINU-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=C(Cl)C=CC(Cl)=C2

Synonyms:

• 1-Propanone, 1-(2,5-dichlorophenyl)-3-(3-methylphenyl)-
• 1-(2,5-Dichlorophenyl)-3-(3-methylphenyl)propan-1-one