CAS 898768-08-6
:3-(4-fluorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one
Description:
3-(4-Fluorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898768-08-6, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 4-fluorophenyl group and a 2-methylsulfanylphenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and interaction with biological systems. The methylthio group (–S–CH3) can influence the compound's solubility and lipophilicity, which are critical for its behavior in various chemical environments. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of more complex molecules or as a precursor in various chemical reactions. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or reference to specialized databases.
Formula:C16H15FOS
InChI:InChI=1/C16H15FOS/c1-19-16-5-3-2-4-14(16)15(18)11-8-12-6-9-13(17)10-7-12/h2-7,9-10H,8,11H2,1H3
SMILES:CSc1ccccc1C(=O)CCc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.