CAS 898768-09-7
:8-(2-iodophenyl)-8-oxo-octanenitrile
Description:
8-(2-Iodophenyl)-8-oxo-octanenitrile, identified by its CAS number 898768-09-7, is a chemical compound that features a complex structure characterized by the presence of an oxo group (C=O) and a nitrile group (C≡N) attached to an octane backbone. The compound includes a phenyl ring substituted with an iodine atom, which can influence its reactivity and biological activity. The presence of the nitrile group suggests potential applications in organic synthesis and medicinal chemistry, as nitriles can serve as precursors to various functional groups. Additionally, the iodine substituent may enhance the compound's lipophilicity and facilitate interactions with biological targets. The overall molecular structure indicates that it may exhibit unique physical and chemical properties, such as solubility in organic solvents and potential reactivity under specific conditions. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, solvent, and the presence of other reagents.
Formula:C14H16INO
InChI:InChI=1/C14H16INO/c15-13-9-6-5-8-12(13)14(17)10-4-2-1-3-7-11-16/h5-6,8-9H,1-4,7,10H2
SMILES:C(CCCC(=O)c1ccccc1I)CCC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.