CAS 898768-11-1
:1-Propanone, 3-(4-fluorophenyl)-1-[4-(methylthio)phenyl]-
Description:
1-Propanone, 3-(4-fluorophenyl)-1-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-fluorophenyl group and a 4-(methylthio)phenyl group. The presence of the fluorine atom introduces electronegative characteristics, potentially influencing the compound's reactivity and polarity. The methylthio group contributes to the compound's overall hydrophobicity and can affect its solubility in various solvents. The molecular structure suggests that it may exhibit interesting biological or pharmacological properties, making it a candidate for research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents. Overall, 1-Propanone, 3-(4-fluorophenyl)-1-[4-(methylthio)phenyl]- is a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C16H15FOS
InChI:InChI=1S/C16H15FOS/c1-19-15-9-5-13(6-10-15)16(18)11-4-12-2-7-14(17)8-3-12/h2-3,5-10H,4,11H2,1H3
InChI key:InChIKey=SRJNJOKWVWGGKL-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(F)C=C1)(=O)C2=CC=C(SC)C=C2
Synonyms:- 1-Propanone, 3-(4-fluorophenyl)-1-[4-(methylthio)phenyl]-
- 3-(4-Fluorophenyl)-1-[4-(methylsulfanyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.