CAS 898768-12-2

3-Chloro-1-(3-chlorophenyl)-1-propanone

Description:

3-Chloro-1-(3-chlorophenyl)-1-propanone, with the CAS number 898768-12-2, is an organic compound characterized by its ketone functional group and the presence of chlorine substituents. This compound features a propanone backbone, where a chlorophenyl group is attached to the first carbon, and a chlorine atom is also substituted on the third carbon of the propanone. The presence of these chlorine atoms contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this may exhibit properties such as moderate to high polarity due to the electronegative chlorine atoms, which can influence solubility in various solvents. Additionally, the structure suggests potential for electrophilic substitution reactions, making it a candidate for further chemical transformations. Safety data sheets would indicate handling precautions due to the presence of chlorine, which can be hazardous. Overall, this compound is of interest in fields such as medicinal chemistry and materials science, where chlorinated compounds often play significant roles.

Formula: C₉H₈Cl₂O

InChI: InChI=1S/C9H8Cl2O/c10-5-4-9(12)7-2-1-3-8(11)6-7/h1-3,6H,4-5H2

InChI key: InChIKey=BPSAVYPGGCKFLO-UHFFFAOYSA-N

SMILES: C(CCCl)(=O)C1=CC(Cl)=CC=C1

Synonyms:

• 1-Propanone, 3-chloro-1-(3-chlorophenyl)-
• 3-Chloro-1-(3-chlorophenyl)propan-1-one
• 1-(3-Chlorophenyl)-3-chloropropan-1-one
• 3-Chloro-1-(3-chlorophenyl)-1-propanone