CAS 898768-16-6

1-(2,4-difluorophenyl)-3-(m-tolyl)propan-1-one

Description:

1-(2,4-Difluorophenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898768-16-6, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 2,4-difluorophenyl group and a m-tolyl group, which contributes to its unique chemical properties. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its reactivity and biological activity. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of aromatic rings that can interact with biological targets. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and functional groups, making it important for practical applications in synthesis and formulation. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₁₆H₁₄F₂O

InChI: InChI=1/C16H14F2O/c1-11-3-2-4-12(9-11)5-8-16(19)14-7-6-13(17)10-15(14)18/h2-4,6-7,9-10H,5,8H2,1H3

SMILES: Cc1cccc(CCC(=O)c2ccc(cc2F)F)c1