CAS 898768-17-7
:6-chloro-1-(2-chlorophenyl)hexan-1-one
Description:
6-Chloro-1-(2-chlorophenyl)hexan-1-one is an organic compound characterized by its ketone functional group and the presence of chlorine substituents. The molecular structure features a hexanone backbone, indicating a six-carbon chain with a carbonyl group (C=O) at one end. The compound includes a 2-chlorophenyl group, which is a phenyl ring substituted with a chlorine atom at the second position, attached to the hexanone chain. This substitution can influence the compound's reactivity and physical properties, such as solubility and boiling point. The presence of chlorine atoms typically enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the compound's specific stereochemistry and potential for isomerism can impact its chemical behavior and interactions. As with many chlorinated organic compounds, safety and environmental considerations are important, as they may exhibit toxicity or persistence in the environment.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c13-9-5-1-2-8-12(15)10-6-3-4-7-11(10)14/h3-4,6-7H,1-2,5,8-9H2
SMILES:C(CCC(=O)c1ccccc1Cl)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.