CymitQuimica logo

CAS 898768-18-8

:

1-(3,4-difluorophenyl)-3-(m-tolyl)propan-1-one

Description:
1-(3,4-Difluorophenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898768-18-8, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where a 3,4-difluorophenyl group and a m-tolyl group are attached to the first and third carbon atoms, respectively. The presence of fluorine atoms in the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interactions in various chemical environments. The m-tolyl group, derived from toluene, contributes to the compound's hydrophobic characteristics. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would typically depend on the specific molecular interactions and the presence of substituents. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of fluorine, which can affect toxicity and environmental impact.
Formula:C16H14F2O
InChI:InChI=1/C16H14F2O/c1-11-3-2-4-12(9-11)5-8-16(19)13-6-7-14(17)15(18)10-13/h2-4,6-7,9-10H,5,8H2,1H3
SMILES:Cc1cccc(CCC(=O)c2ccc(c(c2)F)F)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.