CAS 898768-20-2

7-chloro-1-(2-chlorophenyl)heptan-1-one

Description:

7-Chloro-1-(2-chlorophenyl)heptan-1-one, with the CAS number 898768-20-2, is an organic compound characterized by its heptanone backbone, which features a ketone functional group at the first carbon position. The presence of a 2-chlorophenyl group at the seventh carbon introduces aromatic characteristics and enhances the compound's lipophilicity. The chlorine substituents contribute to the compound's reactivity and potential biological activity, making it of interest in medicinal chemistry and synthetic applications. This compound is likely to exhibit moderate to high solubility in organic solvents, while its polar functional groups may influence its interactions in biological systems. The structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. As with many chlorinated organic compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.

Formula: C₁₃H₁₆Cl₂O

InChI: InChI=1/C13H16Cl2O/c14-10-6-2-1-3-9-13(16)11-7-4-5-8-12(11)15/h4-5,7-8H,1-3,6,9-10H2

SMILES: C(CCCCl)CCC(=O)c1ccccc1Cl