CAS 898768-23-5
:6-chloro-1-(4-iodophenyl)hexan-1-one
Description:
6-Chloro-1-(4-iodophenyl)hexan-1-one is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a chlorine atom and a para-iodophenyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen atoms, specifically chlorine and iodine, can influence the compound's physical properties, such as solubility and boiling point, as well as its reactivity in nucleophilic substitution reactions. Additionally, the aromatic ring from the para-iodophenyl group can provide stability and influence electronic properties. The compound may be utilized in various chemical reactions, including coupling reactions and as an intermediate in the synthesis of more complex molecules. Its specific applications would depend on the context of its use in research or industrial processes. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C12H14ClIO
InChI:InChI=1/C12H14ClIO/c13-9-3-1-2-4-12(15)10-5-7-11(14)8-6-10/h5-8H,1-4,9H2
SMILES:C(CCC(=O)c1ccc(cc1)I)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.