CAS 898768-24-6

1-Propanone, 3-(3-methylphenyl)-1-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 3-(3-methylphenyl)-1-(3,4,5-trifluorophenyl)-, also known by its CAS number 898768-24-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3-methylphenyl group and a 3,4,5-trifluorophenyl group. The presence of the trifluoromethyl groups contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The compound is likely to exhibit moderate volatility and may have a relatively low boiling point compared to larger organic molecules. Its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of fluorinated compounds. Additionally, the presence of multiple aromatic rings may impart stability and influence its interaction with biological systems. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₆H₁₃F₃O

InChI: InChI=1S/C16H13F3O/c1-10-3-2-4-11(7-10)5-6-15(20)12-8-13(17)16(19)14(18)9-12/h2-4,7-9H,5-6H2,1H3

InChI key: InChIKey=PCKFTCZCIGSQKL-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=CC(F)=C(F)C(F)=C2

Synonyms:

• 3-(3-Methylphenyl)-1-(3,4,5-trifluorophenyl)-1-propanone
• 1-Propanone, 3-(3-methylphenyl)-1-(3,4,5-trifluorophenyl)-