CAS 898768-25-7
:1-(2,3-dimethylphenyl)-3-(4-fluorophenyl)propan-1-one
Description:
1-(2,3-Dimethylphenyl)-3-(4-fluorophenyl)propan-1-one, identified by its CAS number 898768-25-7, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 4-fluorophenyl group. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the hydrophobic aromatic rings. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. As with many organic compounds, it is important to handle this substance with care, considering safety protocols related to its potential toxicity and environmental impact. Its applications may span various fields, including pharmaceuticals and materials science, although specific uses would depend on further research and development.
Formula:C17H17FO
InChI:InChI=1/C17H17FO/c1-12-4-3-5-16(13(12)2)17(19)11-8-14-6-9-15(18)10-7-14/h3-7,9-10H,8,11H2,1-2H3
SMILES:Cc1cccc(c1C)C(=O)CCc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.