CymitQuimica logo

CAS 898768-29-1

:

6-chloro-1-(3-iodophenyl)hexan-1-one

Description:
6-Chloro-1-(3-iodophenyl)hexan-1-one is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a chlorine atom and a 3-iodophenyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen atoms, specifically chlorine and iodine, can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity towards nucleophiles. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential for further derivatization, allowing for the exploration of various chemical reactions. Additionally, the compound's stability and behavior under different conditions can be influenced by the steric and electronic effects of the substituents. Overall, 6-chloro-1-(3-iodophenyl)hexan-1-one is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H14ClIO
InChI:InChI=1/C12H14ClIO/c13-8-3-1-2-7-12(15)10-5-4-6-11(14)9-10/h4-6,9H,1-3,7-8H2
SMILES:C(CCC(=O)c1cccc(c1)I)CCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.