CAS 898768-36-0
:1-cyclopentyl-3-(m-tolyl)propan-1-one
Description:
1-Cyclopentyl-3-(m-tolyl)propan-1-one, identified by its CAS number 898768-36-0, is an organic compound characterized by its ketone functional group. It features a cyclopentyl group and a m-tolyl group attached to a propan-1-one backbone, contributing to its unique structural and chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of both cyclopentyl and m-tolyl groups may influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and behavior under various conditions, such as temperature and pH, would be essential for understanding its practical applications and safety profile. As with many organic compounds, proper handling and storage are crucial to ensure safety and maintain its integrity for research or industrial use.
Formula:C15H20O
InChI:InChI=1/C15H20O/c1-12-5-4-6-13(11-12)9-10-15(16)14-7-2-3-8-14/h4-6,11,14H,2-3,7-10H2,1H3
SMILES:Cc1cccc(CCC(=O)C2CCCC2)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.