CAS 898768-42-8
:1-(o-tolyl)-3-(p-tolyl)propan-1-one
Description:
1-(o-Tolyl)-3-(p-tolyl)propan-1-one, with the CAS number 898768-42-8, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with two tolyl groups, one ortho and one para to the carbonyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is likely to be soluble in organic solvents such as ethanol and acetone, while exhibiting limited solubility in water due to its hydrophobic aromatic rings. The presence of the aromatic tolyl groups contributes to its stability and potential for various chemical reactions, including electrophilic aromatic substitution. Additionally, this compound may exhibit interesting properties such as fluorescence or photochemical reactivity, making it of interest in fields like organic synthesis and materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-7-9-15(10-8-13)11-12-17(18)16-6-4-3-5-14(16)2/h3-10H,11-12H2,1-2H3
InChI key:InChIKey=NPEUBUNZTJKBHR-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)CCC(=O)c1ccccc1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.