CymitQuimica logo

CAS 898768-46-2

:

1-(4-chloro-3-fluoro-phenyl)-3-(4-fluorophenyl)propan-1-one

Description:
1-(4-chloro-3-fluoro-phenyl)-3-(4-fluorophenyl)propan-1-one, with the CAS number 898768-46-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone substituted with two distinct aromatic rings: one containing a chlorine and a fluorine atom, and the other containing a fluorine atom. The presence of these halogen substituents can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, such compounds may exhibit interesting biological activities, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the substituents and the overall molecular weight. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application.
Formula:C15H11ClF2O
InChI:InChI=1/C15H11ClF2O/c16-13-7-4-11(9-14(13)18)15(19)8-3-10-1-5-12(17)6-2-10/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(c(c1)F)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.