CAS 898768-48-4
:1-(2-methoxyphenyl)-3-(p-tolyl)propan-1-one
Description:
1-(2-Methoxyphenyl)-3-(p-tolyl)propan-1-one, also known by its CAS number 898768-48-4, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic substituents: a 2-methoxyphenyl group and a p-tolyl group. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound is typically characterized by its molecular structure, which includes a carbonyl group (C=O) that is central to its ketone classification. It may exhibit properties such as moderate volatility and potential reactivity under certain conditions, making it of interest in various chemical applications, including organic synthesis and potentially in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-13-7-9-14(10-8-13)11-12-16(18)15-5-3-4-6-17(15)19-2/h3-10H,11-12H2,1-2H3
SMILES:Cc1ccc(cc1)CCC(=O)c1ccccc1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.