CAS 898768-58-6
:3-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one
Description:
3-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898768-58-6, is an organic compound characterized by its complex structure featuring both fluorinated aromatic rings and a ketone functional group. This compound typically exhibits a high degree of lipophilicity due to the presence of multiple fluorine atoms, which can influence its solubility and reactivity. The fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry and material science. The ketone group contributes to its reactivity, allowing for potential applications in various chemical reactions, including condensation and substitution reactions. Additionally, the presence of the trifluoromethyl group can impart unique biological activities, making this compound a candidate for further investigation in drug development. Overall, its distinctive structural features suggest potential utility in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research and testing.
Formula:C16H12F4O
InChI:InChI=1/C16H12F4O/c17-14-7-4-11(5-8-14)6-9-15(21)12-2-1-3-13(10-12)16(18,19)20/h1-5,7-8,10H,6,9H2
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)CCc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.