CAS 898768-60-0

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-, also known by its CAS number 898768-60-0, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-bromo-2-fluorophenyl group and a 4-fluorophenyl group. The presence of halogen atoms, specifically bromine and fluorine, contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens. Additionally, the compound's physical properties, such as solubility and boiling point, would be influenced by the aromatic rings and the ketone group. Overall, this compound's characteristics make it a subject of interest for further research and development in synthetic chemistry and material science.

Formula: C₁₅H₁₁BrF₂O

InChI: InChI=1/C15H11BrF2O/c16-11-4-7-13(14(18)9-11)15(19)8-3-10-1-5-12(17)6-2-10/h1-2,4-7,9H,3,8H2

InChI key: InChIKey=NQLWHFUZHWGIBW-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(F)C=C1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-
• 1-(4-Bromo-2-fluorophenyl)-3-(4-fluorophenyl)-1-propanone
• 4′-Bromo-2′-fluoro-3-(4-fluorophenyl)propiophenone