CAS 898768-72-4
:1-(2,5-dichlorophenyl)-3-(4-fluorophenyl)propan-1-one
Description:
1-(2,5-Dichlorophenyl)-3-(4-fluorophenyl)propan-1-one, identified by its CAS number 898768-72-4, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a fluorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique electronic properties, potentially influencing its reactivity and interactions in various chemical environments. Typically, such compounds may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's physical properties, such as solubility and melting point, would be influenced by the substituents' electronegative nature and steric effects. Overall, this compound represents a class of substituted ketones that may have significant implications in both synthetic and applied chemistry.
Formula:C15H11Cl2FO
InChI:InChI=1/C15H11Cl2FO/c16-11-4-7-14(17)13(9-11)15(19)8-3-10-1-5-12(18)6-2-10/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1cc(ccc1Cl)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.