CymitQuimica logo

CAS 898768-74-6

:

1-(3,4-dichlorophenyl)-3-(4-fluorophenyl)propan-1-one

Description:
1-(3,4-Dichlorophenyl)-3-(4-fluorophenyl)propan-1-one, identified by its CAS number 898768-74-6, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,4-dichlorophenyl group and a 4-fluorophenyl group. The presence of chlorine and fluorine atoms in the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity, polarity, and biological activity. The compound is likely to be a solid at room temperature, given the stability of similar aromatic ketones. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of compounds with specific biological activities. Additionally, the presence of halogens may enhance its lipophilicity, affecting its solubility and interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C15H11Cl2FO
InChI:InChI=1/C15H11Cl2FO/c16-13-7-4-11(9-14(13)17)15(19)8-3-10-1-5-12(18)6-2-10/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(c(c1)Cl)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.