CymitQuimica logo

CAS 898768-77-9

:

1-Propanone, 1-(2,3-dimethylphenyl)-3-(4-methylphenyl)-

Description:
1-Propanone, 1-(2,3-dimethylphenyl)-3-(4-methylphenyl)-, also known by its CAS number 898768-77-9, is an organic compound characterized by its ketone functional group. It features a propanone backbone with two aromatic substituents: a 2,3-dimethylphenyl group and a 4-methylphenyl group. This structure contributes to its unique physical and chemical properties, including its potential solubility in organic solvents and moderate volatility. The presence of multiple methyl groups on the aromatic rings can influence its reactivity and stability, making it of interest in various chemical applications, including organic synthesis and materials science. The compound may exhibit distinct optical and electronic properties due to its conjugated system, which can be relevant in fields such as dye chemistry or pharmaceuticals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a complex structure that may have diverse applications in chemical research and industry.
Formula:C18H20O
InChI:InChI=1S/C18H20O/c1-13-7-9-16(10-8-13)11-12-18(19)17-6-4-5-14(2)15(17)3/h4-10H,11-12H2,1-3H3
InChI key:InChIKey=DAXJNSGGBFVNPC-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(C)C=C1)(=O)C2=C(C)C(C)=CC=C2
Synonyms:
  • 1-Propanone, 1-(2,3-dimethylphenyl)-3-(4-methylphenyl)-
  • 1-(2,3-Dimethylphenyl)-3-(4-methylphenyl)propan-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.