CymitQuimica logo

CAS 898768-78-0

:

1-(3,4-difluorophenyl)-3-(4-fluorophenyl)propan-1-one

Description:
1-(3,4-Difluorophenyl)-3-(4-fluorophenyl)propan-1-one, with the CAS number 898768-78-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone substituted with two fluorinated phenyl groups, which significantly influence its chemical properties. The presence of fluorine atoms enhances the compound's lipophilicity and may affect its reactivity and stability. Typically, such compounds exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the fluorine substitutions, which can alter intermolecular interactions. Overall, 1-(3,4-difluorophenyl)-3-(4-fluorophenyl)propan-1-one represents a class of fluorinated organic compounds that are valuable in various chemical research and industrial applications.
Formula:C15H11F3O
InChI:InChI=1/C15H11F3O/c16-12-5-1-10(2-6-12)3-8-15(19)11-4-7-13(17)14(18)9-11/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.