CAS 898768-80-4
:1-Propanone, 1-(3,5-difluorophenyl)-3-(4-fluorophenyl)-
Description:
1-Propanone, 1-(3,5-difluorophenyl)-3-(4-fluorophenyl)-, also known by its CAS number 898768-80-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with two distinct aromatic rings: one containing two fluorine atoms in the 3 and 5 positions and the other containing a single fluorine atom in the para position. The presence of these fluorine substituents significantly influences the compound's physical and chemical properties, such as its polarity, boiling point, and reactivity. Typically, compounds with fluorinated aromatic rings exhibit enhanced stability and lipophilicity, making them of interest in various applications, including pharmaceuticals and agrochemicals. The specific arrangement of substituents can also affect the compound's biological activity, making it a subject of study in medicinal chemistry. Overall, this compound exemplifies the complexity and utility of fluorinated organic molecules in chemical research and industry.
Formula:C15H11F3O
InChI:InChI=1S/C15H11F3O/c16-12-4-1-10(2-5-12)3-6-15(19)11-7-13(17)9-14(18)8-11/h1-2,4-5,7-9H,3,6H2
InChI key:InChIKey=FOCNQOCPHKBMAB-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(F)C=C1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:- 1-(3,5-Difluorophenyl)-3-(4-fluorophenyl)-1-propanone
- 1-Propanone, 1-(3,5-difluorophenyl)-3-(4-fluorophenyl)-
- 3′,5′-Difluoro-3-(4-fluorophenyl)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.