CymitQuimica logo

CAS 898768-84-8

:

1-Propanone, 1-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-

Description:
1-Propanone, 1-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-, also known by its CAS number 898768-84-8, is an organic compound characterized by its ketone functional group. It features a propanone backbone with two distinct aromatic substituents: a 2,6-dichlorophenyl group and a 4-fluorophenyl group. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, given the presence of halogenated aromatic rings, which can enhance biological activity. The dichlorophenyl and fluorophenyl groups may contribute to its reactivity and interaction with biological targets. Additionally, the compound's properties, such as boiling point, melting point, and density, would be influenced by the substituents' electronic and steric effects. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a specific class of ketones with potential utility in various chemical applications.
Formula:C15H11Cl2FO
InChI:InChI=1S/C15H11Cl2FO/c16-12-2-1-3-13(17)15(12)14(19)9-6-10-4-7-11(18)8-5-10/h1-5,7-8H,6,9H2
InChI key:InChIKey=KXUSCFNLJLEOJE-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(F)C=C1)(=O)C2=C(Cl)C=CC=C2Cl
Synonyms:
  • 1-Propanone, 1-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-
  • 2′,6′-Dichloro-3-(4-fluorophenyl)propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.