CAS 898768-89-3

1-(4-bromo-3-fluoro-phenyl)-3-(p-tolyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(p-tolyl)propan-1-one, with the CAS number 898768-89-3, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone substituted with a 4-bromo-3-fluorophenyl group and a p-tolyl group, contributing to its unique chemical properties. The presence of bromine and fluorine atoms introduces significant electronegativity, which can influence the compound's reactivity and polarity. The aromatic rings provide stability and can participate in various chemical reactions, such as electrophilic substitutions. This compound may exhibit interesting biological activities due to its structural features, making it of potential interest in medicinal chemistry. Additionally, its molecular structure suggests it could be involved in various synthetic pathways, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.

Formula: C₁₆H₁₄BrFO

InChI: InChI=1/C16H14BrFO/c1-11-2-4-12(5-3-11)6-9-16(19)13-7-8-14(17)15(18)10-13/h2-5,7-8,10H,6,9H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)Br