CAS 898768-90-6

1-cyclopentyl-3-(4-fluorophenyl)propan-1-one

Description:

1-Cyclopentyl-3-(4-fluorophenyl)propan-1-one, with the CAS number 898768-90-6, is an organic compound characterized by its ketone functional group and a unique structure that includes a cyclopentyl ring and a para-fluorophenyl substituent. This compound typically exhibits a moderate to high lipophilicity due to the presence of the cyclopentyl and phenyl groups, which can influence its solubility in organic solvents. The fluorine atom on the phenyl ring can enhance the compound's reactivity and biological activity, potentially affecting its interaction with biological targets. In terms of physical properties, it may have a specific melting point and boiling point, which are influenced by its molecular structure. The compound is of interest in medicinal chemistry and drug development, particularly for its potential applications in pharmacology. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks if ingested or inhaled.

Formula: C₁₄H₁₇FO

InChI: InChI=1/C14H17FO/c15-13-8-5-11(6-9-13)7-10-14(16)12-3-1-2-4-12/h5-6,8-9,12H,1-4,7,10H2

SMILES: C1CCC(C1)C(=O)CCc1ccc(cc1)F

Synonyms:

• CYCLOPENTYL 2-(4-FLUOROPHENYL)ETHYL KETONE
• 1-Propanone, 1-cyclopentyl-3-(4-fluorophenyl)-