CAS 898768-91-7

1-(4-chloro-3-fluoro-phenyl)-3-(p-tolyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(p-tolyl)propan-1-one, with the CAS number 898768-91-7, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 4-chloro-3-fluorophenyl group and a p-tolyl group, contributing to its unique chemical properties. The presence of halogen atoms, such as chlorine and fluorine, often enhances the compound's reactivity and can influence its biological activity. This compound is likely to be a solid at room temperature, given its structural complexity and the presence of aromatic rings, which typically confer stability. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substitutions can modulate biological activity. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could participate in various chemical reactions, including nucleophilic substitutions or reductions, due to the functional groups present. Overall, this compound represents a class of substituted ketones with potential utility in synthetic organic chemistry.

Formula: C₁₆H₁₄ClFO

InChI: InChI=1/C16H14ClFO/c1-11-2-4-12(5-3-11)6-9-16(19)13-7-8-14(17)15(18)10-13/h2-5,7-8,10H,6,9H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)Cl