CymitQuimica logo

CAS 898768-94-0

:

3-(2,3-dimethylphenyl)-1-phenyl-propan-1-one

Description:
3-(2,3-Dimethylphenyl)-1-phenyl-propan-1-one, identified by its CAS number 898768-94-0, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two phenyl groups and a dimethyl-substituted phenyl group, contributing to its complex structure. This compound is typically characterized by its aromatic nature, which can influence its reactivity and interactions with other substances. It may exhibit properties such as moderate to high lipophilicity due to the presence of multiple aromatic rings, which can affect its solubility in various solvents. Additionally, the presence of the ketone functional group suggests potential reactivity in nucleophilic addition reactions. The compound may also be of interest in various applications, including organic synthesis and materials science, particularly in the development of photoinitiators or as intermediates in the synthesis of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-7-6-10-15(14(13)2)11-12-17(18)16-8-4-3-5-9-16/h3-10H,11-12H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2ccccc2)c1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.