CAS 898768-97-3

1-(2-fluorophenyl)-3-(p-tolyl)propan-1-one

Description:

1-(2-Fluorophenyl)-3-(p-tolyl)propan-1-one, identified by its CAS number 898768-97-3, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic substituents: a 2-fluorophenyl group and a p-tolyl group. The presence of the fluorine atom in the 2-position of the phenyl ring can influence the compound's electronic properties and reactivity, potentially enhancing its lipophilicity and biological activity. The p-tolyl group, derived from toluene, contributes to the compound's hydrophobic characteristics. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₁₅FO

InChI: InChI=1/C16H15FO/c1-12-6-8-13(9-7-12)10-11-16(18)14-4-2-3-5-15(14)17/h2-9H,10-11H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)c1ccccc1F