CAS 898768-99-5

3-(p-tolyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(p-Tolyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898768-99-5, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a p-tolyl group (a para-methylphenyl group) and a 2-(trifluoromethyl)phenyl group, which introduces significant electron-withdrawing properties due to the trifluoromethyl group. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic substituents, influencing its solubility in organic solvents. The presence of the trifluoromethyl group can enhance the compound's stability and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the structural arrangement suggests potential for specific interactions in biological systems, which may be explored in drug design or synthesis. Overall, the compound's unique combination of functional groups and structural features contributes to its potential utility in synthetic chemistry and material science.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1/C17H15F3O/c1-12-6-8-13(9-7-12)10-11-16(21)14-4-2-3-5-15(14)17(18,19)20/h2-9H,10-11H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)c1ccccc1C(F)(F)F